C31H36Cl2FN5O — CID 145231331
N-[(E)-1-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-1-imino-3-methylpent-2-en-2-yl]-5-fluoro-2-methyl-4-piperidin-1-ylaniline (PubChem CID 145231331) has the molecular formula C31H36Cl2FN5O and a molecular weight of 584.57 g/mol. Its IUPAC name is N-[(E)-1-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-1-imino-3-methylpent-2-en-2-yl]-5-fluoro-2-methyl-4-piperidin-1-ylaniline.
| Compound Name | N-[(E)-1-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-1-imino-3-methylpent-2-en-2-yl]-5-fluoro-2-methyl-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 145231331 |
| Molecular Formula | C31H36Cl2FN5O |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-[(E)-1-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-1-imino-3-methylpent-2-en-2-yl]-5-fluoro-2-methyl-4-piperidin-1-ylaniline |
| SMILES | [H]/N=C(C(/Nc1cc(F)c(N2CCCCC2)cc1C)=C(/C)CC)\c1cc(OC(C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C31H36Cl2FN5O/c1-5-18(2)31(38-27-15-25(34)28(13-19(27)3)39-11-7-6-8-12-39)30(36)22-14-21(9-10-26(22)35)40-20(4)29-23(32)16-37-17-24(29)33/h9-10,13-17,20,36,38H,5-8,11-12,35H2,1-4H3/b31-18+,36-30+ |
| InChIKey | XJYDRZLSFXZRRV-XFYQUHLQSA-N |
| XLogP | 8.71 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|