About 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one
8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one (PubChem CID 14523217) has the molecular formula C15H9NO4
and a molecular weight of 267.24 g/mol. Its IUPAC name is 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one.
Molecular Properties
| Compound Name | 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one |
| PubChem CID | 14523217 |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one |
| SMILES | O=c1[nH]c2ccccc2c2oc3cc(O)c(O)cc3c12 |
| InChI | InChI=1S/C15H9NO4/c17-10-5-8-12(6-11(10)18)20-14-7-3-1-2-4-9(7)16-15(19)13(8)14/h1-6,17-18H,(H,16,19) |
| InChIKey | NHLHIEVWZDBSKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one?
The IUPAC name of 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one (CID 14523217) is 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one.
What is the SMILES notation for 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one?
The canonical SMILES for 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one is O=c1[nH]c2ccccc2c2oc3cc(O)c(O)cc3c12.
What is the InChIKey of 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one?
The InChIKey is NHLHIEVWZDBSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO4/c17-10-5-8-12(6-11(10)18)20-14-7-3-1-2-4-9(7)16-15(19)13(8)14/h1-6,17-18H,(H,16,19).
What are the key properties of 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one?
8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one has a molecular weight of 267.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydroxy-5H-[1]benzofuro[3,2-c]quinolin-6-one is sourced from PubChem (CID 14523217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).