C38H21N3O6S — CID 145232555
6-[2-(9-thia-24-azahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),2(10),3,5,7,11,13,15,18,20,22-undecaen-24-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]benzene-1,2,3,4,5-pentol (PubChem CID 145232555) has the molecular formula C38H21N3O6S and a molecular weight of 647.67 g/mol. Its IUPAC name is 6-[2-(9-thia-24-azahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),2(10),3,5,7,11,13,15,18,20,22-undecaen-24-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[2-(9-thia-24-azahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),2(10),3,5,7,11,13,15,18,20,22-undecaen-24-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 145232555 |
| Molecular Formula | C38H21N3O6S |
| Molecular Weight | 647.67 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | 6-[2-(9-thia-24-azahexacyclo[15.7.0.02,10.03,8.011,16.018,23]tetracosa-1(17),2(10),3,5,7,11,13,15,18,20,22-undecaen-24-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-n3c4ccccc4c4c5ccccc5c5sc6ccccc6c5c43)nc3c2oc2ccccc23)c(O)c1O |
| InChI | InChI=1S/C38H21N3O6S/c42-31-27(32(43)34(45)35(46)33(31)44)29-36-28(20-12-4-7-15-23(20)47-36)39-38(40-29)41-22-14-6-3-11-19(22)25-17-9-1-2-10-18(17)37-26(30(25)41)21-13-5-8-16-24(21)48-37/h1-16,42-46H |
| InChIKey | MVHIBQMRUCGHQA-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.67 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|