C29H25F7N2O2S — CID 145232893
(5S)-5-[2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one (PubChem CID 145232893) has the molecular formula C29H25F7N2O2S and a molecular weight of 598.58 g/mol. Its IUPAC name is (5S)-5-[2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one.
| Compound Name | (5S)-5-[2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 145232893 |
| Molecular Formula | C29H25F7N2O2S |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | (5S)-5-[2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-one |
| SMILES | COc1cc(F)c(C(C)C)cc1-c1ccc(C(F)(F)F)cc1[C@@H]1CCC2C(c3ccnc(C(F)(F)F)c3)SC(=O)N21 |
| InChI | InChI=1S/C29H25F7N2O2S/c1-14(2)18-12-20(24(40-3)13-21(18)30)17-5-4-16(28(31,32)33)11-19(17)22-6-7-23-26(41-27(39)38(22)23)15-8-9-37-25(10-15)29(34,35)36/h4-5,8-14,22-23,26H,6-7H2,1-3H3/t22-,23?,26?/m0/s1 |
| InChIKey | OCWSBNXIHVDDLA-MFNHVEPQSA-N |
| XLogP | 9.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|