C34H27F6N3O4S — CID 145232900
4-[6-methoxy-5-[2-[(5S)-3-oxo-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-5-yl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]-3,5-dimethylbenzoic acid (PubChem CID 145232900) has the molecular formula C34H27F6N3O4S and a molecular weight of 687.66 g/mol. Its IUPAC name is 4-[6-methoxy-5-[2-[(5S)-3-oxo-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-5-yl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[6-methoxy-5-[2-[(5S)-3-oxo-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-5-yl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 145232900 |
| Molecular Formula | C34H27F6N3O4S |
| Molecular Weight | 687.66 g/mol |
| Exact Mass | 687.16 |
| IUPAC Name | 4-[6-methoxy-5-[2-[(5S)-3-oxo-1-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-5-yl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]-3,5-dimethylbenzoic acid |
| SMILES | COc1ncc(-c2c(C)cc(C(=O)O)cc2C)cc1-c1ccc(C(F)(F)F)cc1[C@@H]1CCC2C(c3ccnc(C(F)(F)F)c3)SC(=O)N21 |
| InChI | InChI=1S/C34H27F6N3O4S/c1-16-10-19(31(44)45)11-17(2)28(16)20-12-24(30(47-3)42-15-20)22-5-4-21(33(35,36)37)14-23(22)25-6-7-26-29(48-32(46)43(25)26)18-8-9-41-27(13-18)34(38,39)40/h4-5,8-15,25-26,29H,6-7H2,1-3H3,(H,44,45)/t25-,26?,29?/m0/s1 |
| InChIKey | NMEFOFOOMUINIU-OIOREYSGSA-N |
| XLogP | 9.29 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.66 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|