About CID 145233282
CID 145233282 (PubChem CID 145233282) has the molecular formula C7H9N2
and a molecular weight of 121.16 g/mol.
Molecular Properties
| Compound Name | CID 145233282 |
|---|
| PubChem CID | 145233282 |
|---|
| Molecular Formula | C7H9N2 |
|---|
| Molecular Weight | 121.16 g/mol |
|---|
| Exact Mass | 121.08 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C1=C[C]2N=CNC2C=C1.[H][H] |
|---|
| InChI | InChI=1S/C7H7N2.H2/c1-2-4-7-6(3-1)8-5-9-7;/h1-6H,(H,8,9);1H |
|---|
| InChIKey | DIGVOGACWCLBLO-UHFFFAOYSA-N |
|---|
| XLogP | 0.89 |
|---|
| TPSA | 24.39 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 145233282 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145233282?
The IUPAC name of CID 145233282 (CID 145233282) is not available.
What is the SMILES notation for CID 145233282?
The canonical SMILES for CID 145233282 is C1=C[C]2N=CNC2C=C1.[H][H].
What is the InChIKey of CID 145233282?
The InChIKey is DIGVOGACWCLBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2.H2/c1-2-4-7-6(3-1)8-5-9-7;/h1-6H,(H,8,9);1H.
What are the key properties of CID 145233282?
CID 145233282 has a molecular weight of 121.16 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145233282 is sourced from PubChem (CID 145233282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).