About CID 145233283
CID 145233283 (PubChem CID 145233283) has the molecular formula C7H7N2
and a molecular weight of 119.15 g/mol.
Molecular Properties
| Compound Name | CID 145233283 |
| PubChem CID | 145233283 |
| Molecular Formula | C7H7N2 |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | — |
| SMILES | C1=C[C]2N=CNC2C=C1 |
| InChI | InChI=1S/C7H7N2/c1-2-4-7-6(3-1)8-5-9-7/h1-6H,(H,8,9) |
| InChIKey | KXHCPWRBCRAMHZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 145233283 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145233283?
The IUPAC name of CID 145233283 (CID 145233283) is not available.
What is the SMILES notation for CID 145233283?
The canonical SMILES for CID 145233283 is C1=C[C]2N=CNC2C=C1.
What is the InChIKey of CID 145233283?
The InChIKey is KXHCPWRBCRAMHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2/c1-2-4-7-6(3-1)8-5-9-7/h1-6H,(H,8,9).
What are the key properties of CID 145233283?
CID 145233283 has a molecular weight of 119.15 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145233283 is sourced from PubChem (CID 145233283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).