About 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid
2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid (PubChem CID 145233707) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid.
Molecular Properties
| Compound Name | 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid |
| PubChem CID | 145233707 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid |
| SMILES | C=C/C=C(\C=C)C(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C13H20N2O3/c1-3-7-10(4-2)12(16)15-9-6-5-8-11(14)13(17)18/h3-4,7,11H,1-2,5-6,8-9,14H2,(H,15,16)(H,17,18)/b10-7+ |
| InChIKey | ZALOGDMYLQZLEM-JXMROGBWSA-N |
| XLogP | 0.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid?
The IUPAC name of 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid (CID 145233707) is 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid.
What is the SMILES notation for 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid?
The canonical SMILES for 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid is C=C/C=C(\C=C)C(=O)NCCCCC(N)C(=O)O.
What is the InChIKey of 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid?
The InChIKey is ZALOGDMYLQZLEM-JXMROGBWSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-3-7-10(4-2)12(16)15-9-6-5-8-11(14)13(17)18/h3-4,7,11H,1-2,5-6,8-9,14H2,(H,15,16)(H,17,18)/b10-7+.
What are the key properties of 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid?
2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid has a molecular weight of 252.31 g/mol, XLogP of 0.98, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]hexanoic acid is sourced from PubChem (CID 145233707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).