C15H15NO — CID 145233726
4,5-di(cyclohexa-1,5-dien-1-yl)-1,3-oxazole (PubChem CID 145233726) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 4,5-di(cyclohexa-1,5-dien-1-yl)-1,3-oxazole.
| Compound Name | 4,5-di(cyclohexa-1,5-dien-1-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 145233726 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4,5-di(cyclohexa-1,5-dien-1-yl)-1,3-oxazole |
| SMILES | C1=CC(c2ncoc2C2=CCCC=C2)=CCC1 |
| InChI | InChI=1S/C15H15NO/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h3,5,7-11H,1-2,4,6H2 |
| InChIKey | WUJZNKRMIGGRDO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |