C28H27N5 — CID 145233741
2-[2-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]ethyl-[(4,5-diphenyl-1H-imidazol-2-yl)methyl]amino]acetonitrile (PubChem CID 145233741) has the molecular formula C28H27N5 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[2-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]ethyl-[(4,5-diphenyl-1H-imidazol-2-yl)methyl]amino]acetonitrile.
| Compound Name | 2-[2-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]ethyl-[(4,5-diphenyl-1H-imidazol-2-yl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 145233741 |
| Molecular Formula | C28H27N5 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-[2-[4,5-bis(ethenyl)-1H-pyrrol-3-yl]ethyl-[(4,5-diphenyl-1H-imidazol-2-yl)methyl]amino]acetonitrile |
| SMILES | C=Cc1[nH]cc(CCN(CC#N)Cc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1C=C |
| InChI | InChI=1S/C28H27N5/c1-3-24-23(19-30-25(24)4-2)15-17-33(18-16-29)20-26-31-27(21-11-7-5-8-12-21)28(32-26)22-13-9-6-10-14-22/h3-14,19,30H,1-2,15,17-18,20H2,(H,31,32) |
| InChIKey | VRPGGWPOQSVBGF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|