C31H36N4O4S2 — CID 145233933
[7-[3-(5-formylbenzotriazol-1-yl)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;prop-1-ene (PubChem CID 145233933) has the molecular formula C31H36N4O4S2 and a molecular weight of 592.79 g/mol. Its IUPAC name is [7-[3-(5-formylbenzotriazol-1-yl)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;prop-1-ene.
| Compound Name | [7-[3-(5-formylbenzotriazol-1-yl)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;prop-1-ene |
|---|---|
| PubChem CID | 145233933 |
| Molecular Formula | C31H36N4O4S2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [7-[3-(5-formylbenzotriazol-1-yl)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;prop-1-ene |
| SMILES | C=CC.O=Cc1ccc2c(c1)nnn2CCCN1CCC2(CC1)CC(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C28H30N4O4S2.C3H6/c33-19-20-6-7-23-22(16-20)29-30-32(23)11-3-10-31-12-8-27(9-13-31)17-21(18-27)36-26(34)28(35,24-4-1-14-37-24)25-5-2-15-38-25;1-3-2/h1-2,4-7,14-16,19,21,35H,3,8-13,17-18H2;3H,1H2,2H3 |
| InChIKey | JORNGFZCQSCVSF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|