C15H19N3O4 — CID 14523410
(3aR,5R,6S,6aR)-5-(azidomethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 14523410) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-(azidomethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-(azidomethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 14523410 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-(azidomethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H](CN=[N+]=[N-])[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(2)21-13-12(19-9-10-6-4-3-5-7-10)11(8-17-18-16)20-14(13)22-15/h3-7,11-14H,8-9H2,1-2H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | ZUJKCXSMKKANGG-XJFOESAGSA-N |
| XLogP | 2.76 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|