C20H21NO5 — CID 14523424
benzyl (2S,3R,4R)-2-formyl-4-hydroxy-3-phenylmethoxypyrrolidine-1-carboxylate (PubChem CID 14523424) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is benzyl (2S,3R,4R)-2-formyl-4-hydroxy-3-phenylmethoxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R)-2-formyl-4-hydroxy-3-phenylmethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14523424 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | benzyl (2S,3R,4R)-2-formyl-4-hydroxy-3-phenylmethoxypyrrolidine-1-carboxylate |
| SMILES | O=C[C@@H]1[C@@H](OCc2ccccc2)[C@H](O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c22-12-17-19(25-13-15-7-3-1-4-8-15)18(23)11-21(17)20(24)26-14-16-9-5-2-6-10-16/h1-10,12,17-19,23H,11,13-14H2/t17-,18-,19-/m1/s1 |
| InChIKey | BFSLBUYNBZNVCY-GUDVDZBRSA-N |
| XLogP | 2.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|