C18H17F3O2 — CID 145234999
3,7-diethoxy-1,2,8-trifluoro-2,3-dihydroanthracene (PubChem CID 145234999) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 3,7-diethoxy-1,2,8-trifluoro-2,3-dihydroanthracene.
| Compound Name | 3,7-diethoxy-1,2,8-trifluoro-2,3-dihydroanthracene |
|---|---|
| PubChem CID | 145234999 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3,7-diethoxy-1,2,8-trifluoro-2,3-dihydroanthracene |
| SMILES | CCOc1ccc2cc3c(cc2c1F)=C(F)C(F)C(OCC)C=3 |
| InChI | InChI=1S/C18H17F3O2/c1-3-22-14-6-5-10-7-11-8-15(23-4-2)18(21)17(20)13(11)9-12(10)16(14)19/h5-9,15,18H,3-4H2,1-2H3 |
| InChIKey | LTNBFNVEZXTMGF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |