C42H79NO — CID 145235118
acetaldehyde;N,N-dimethylmethanamine;1-[(Z)-8-ethyl-2,3,6-trimethyl-7,10-dimethylidenedodec-8-enyl]-2-methyl-4-(4-pentylcyclohexyl)cyclohexane (PubChem CID 145235118) has the molecular formula C42H79NO and a molecular weight of 614.10 g/mol. Its IUPAC name is acetaldehyde;N,N-dimethylmethanamine;1-[(Z)-8-ethyl-2,3,6-trimethyl-7,10-dimethylidenedodec-8-enyl]-2-methyl-4-(4-pentylcyclohexyl)cyclohexane.
| Compound Name | acetaldehyde;N,N-dimethylmethanamine;1-[(Z)-8-ethyl-2,3,6-trimethyl-7,10-dimethylidenedodec-8-enyl]-2-methyl-4-(4-pentylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 145235118 |
| Molecular Formula | C42H79NO |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.62 |
| IUPAC Name | acetaldehyde;N,N-dimethylmethanamine;1-[(Z)-8-ethyl-2,3,6-trimethyl-7,10-dimethylidenedodec-8-enyl]-2-methyl-4-(4-pentylcyclohexyl)cyclohexane |
| SMILES | C=C(/C=C(/CC)C(=C)C(C)CCC(C)C(C)CC1CCC(C2CCC(CCCCC)CC2)CC1C)CC.CC=O.CN(C)C |
| InChI | InChI=1S/C37H66.C3H9N.C2H4O/c1-10-13-14-15-33-18-20-35(21-19-33)37-23-22-36(31(8)26-37)25-30(7)28(5)16-17-29(6)32(9)34(12-3)24-27(4)11-2;1-4(2)3;1-2-3/h24,28-31,33,35-37H,4,9-23,25-26H2,1-3,5-8H3;1-3H3;2H,1H3/b34-24-;; |
| InChIKey | SKJRIWLSUDYJSO-NEIQUHQMSA-N |
| XLogP | 12.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|