About 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol
3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol (PubChem CID 145235291) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol |
| PubChem CID | 145235291 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCC(O)(CC)C(C)C |
| InChI | InChI=1S/C8H18O.C4H10O/c1-5-8(9,6-2)7(3)4;1-4(2,3)5/h7,9H,5-6H2,1-4H3;5H,1-3H3 |
| InChIKey | AQZLUXUUZRXXKS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol?
The IUPAC name of 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol (CID 145235291) is 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol.
What is the SMILES notation for 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol?
The canonical SMILES for 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol is CC(C)(C)O.CCC(O)(CC)C(C)C.
What is the InChIKey of 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol?
The InChIKey is AQZLUXUUZRXXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C4H10O/c1-5-8(9,6-2)7(3)4;1-4(2,3)5/h7,9H,5-6H2,1-4H3;5H,1-3H3.
What are the key properties of 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol?
3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol has a molecular weight of 204.35 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methylpentan-3-ol;2-methylpropan-2-ol is sourced from PubChem (CID 145235291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).