About ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate
ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate (PubChem CID 145235403) has the molecular formula C21H24F2N2O2
and a molecular weight of 374.43 g/mol. Its IUPAC name is ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate.
Molecular Properties
| Compound Name | ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate |
| PubChem CID | 145235403 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate |
| SMILES | C=CO/C(=N\C(=C)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2)C(C)(F)F |
| InChI | InChI=1S/C21H24F2N2O2/c1-4-27-20(21(3,22)23)24-14(2)15-10-11-16-13-25(19(26)18(16)12-15)17-8-6-5-7-9-17/h4,10-12,17H,1-2,5-9,13H2,3H3/b24-20- |
| InChIKey | UPRQDFNWPQDZBB-GFMRDNFCSA-N |
| XLogP | 5.16 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate?
The IUPAC name of ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate (CID 145235403) is ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate.
What is the SMILES notation for ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate?
The canonical SMILES for ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate is C=CO/C(=N\C(=C)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2)C(C)(F)F.
What is the InChIKey of ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate?
The InChIKey is UPRQDFNWPQDZBB-GFMRDNFCSA-N. The full InChI is InChI=1S/C21H24F2N2O2/c1-4-27-20(21(3,22)23)24-14(2)15-10-11-16-13-25(19(26)18(16)12-15)17-8-6-5-7-9-17/h4,10-12,17H,1-2,5-9,13H2,3H3/b24-20-.
What are the key properties of ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate?
ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate has a molecular weight of 374.43 g/mol, XLogP of 5.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl N-[1-(2-cyclohexyl-3-oxo-1H-isoindol-5-yl)ethenyl]-2,2-difluoropropanimidate is sourced from PubChem (CID 145235403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).