About N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine
N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine (PubChem CID 145235503) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine |
| PubChem CID | 145235503 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3c(c2)C=CCC3)cc1 |
| InChI | InChI=1S/C20H23N/c1-20(2,3)17-9-12-18(13-10-17)21-19-11-8-15-6-4-5-7-16(15)14-19/h5,7-14,21H,4,6H2,1-3H3 |
| InChIKey | QUECWCKMIWFRAO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine?
The IUPAC name of N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine (CID 145235503) is N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine.
What is the SMILES notation for N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine?
The canonical SMILES for N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine is CC(C)(C)c1ccc(Nc2ccc3c(c2)C=CCC3)cc1.
What is the InChIKey of N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine?
The InChIKey is QUECWCKMIWFRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N/c1-20(2,3)17-9-12-18(13-10-17)21-19-11-8-15-6-4-5-7-16(15)14-19/h5,7-14,21H,4,6H2,1-3H3.
What are the key properties of N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine?
N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine has a molecular weight of 277.41 g/mol, XLogP of 5.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-5,6-dihydronaphthalen-2-amine is sourced from PubChem (CID 145235503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).