C29H29N7O3S — CID 145236557
3-[[5-[2-(1-methylcyclobutyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 145236557) has the molecular formula C29H29N7O3S and a molecular weight of 555.66 g/mol. Its IUPAC name is 3-[[5-[2-(1-methylcyclobutyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-[[5-[2-(1-methylcyclobutyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145236557 |
| Molecular Formula | C29H29N7O3S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 3-[[5-[2-(1-methylcyclobutyl)-5-morpholin-4-yl-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CC1(c2nc(-c3nnc(NC4N=C(c5ccccc5)c5ccccc5NC4=O)o3)c(N3CCOCC3)s2)CCC1 |
| InChI | InChI=1S/C29H29N7O3S/c1-29(12-7-13-29)27-32-22(26(40-27)36-14-16-38-17-15-36)25-34-35-28(39-25)33-23-24(37)30-20-11-6-5-10-19(20)21(31-23)18-8-3-2-4-9-18/h2-6,8-11,23H,7,12-17H2,1H3,(H,30,37)(H,33,35) |
| InChIKey | KUZJWWHPHHNELR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |