C24H18F3N5O2 — CID 145236593
5-phenyl-3-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]amino]-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 145236593) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is 5-phenyl-3-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]amino]-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-phenyl-3-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]amino]-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145236593 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 5-phenyl-3-[[5-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]amino]-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccccc2C(c2ccccc2)=NC1NC1NN=C(c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C24H18F3N5O2/c25-24(26,27)16-12-10-15(11-13-16)22-31-32-23(34-22)30-20-21(33)28-18-9-5-4-8-17(18)19(29-20)14-6-2-1-3-7-14/h1-13,20,23,30,32H,(H,28,33) |
| InChIKey | XHJFAKQONZTXGM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |