C19H24ClIN2O2 — CID 145237054
4-chloro-N'-(cyclohexa-1,5-diene-1-carbonyl)-N'-methylbenzohydrazide;1-iodobutane (PubChem CID 145237054) has the molecular formula C19H24ClIN2O2 and a molecular weight of 474.77 g/mol. Its IUPAC name is 4-chloro-N'-(cyclohexa-1,5-diene-1-carbonyl)-N'-methylbenzohydrazide;1-iodobutane.
| Compound Name | 4-chloro-N'-(cyclohexa-1,5-diene-1-carbonyl)-N'-methylbenzohydrazide;1-iodobutane |
|---|---|
| PubChem CID | 145237054 |
| Molecular Formula | C19H24ClIN2O2 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 4-chloro-N'-(cyclohexa-1,5-diene-1-carbonyl)-N'-methylbenzohydrazide;1-iodobutane |
| SMILES | CCCCI.CN(NC(=O)c1ccc(Cl)cc1)C(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C15H15ClN2O2.C4H9I/c1-18(15(20)12-5-3-2-4-6-12)17-14(19)11-7-9-13(16)10-8-11;1-2-3-4-5/h3,5-10H,2,4H2,1H3,(H,17,19);2-4H2,1H3 |
| InChIKey | WEOPGODZOZSJMK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|