About ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one
ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one (PubChem CID 145237095) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one.
Molecular Properties
| Compound Name | ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one |
| PubChem CID | 145237095 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one |
| SMILES | C.C=CC(=O)/C(C=C)=N/C=C(C)CC.CC |
| InChI | InChI=1S/C11H15NO.C2H6.CH4/c1-5-9(4)8-12-10(6-2)11(13)7-3;1-2;/h6-8H,2-3,5H2,1,4H3;1-2H3;1H4/b9-8?,12-10+;; |
| InChIKey | WZHCNSJFAZILAV-UIXGFHDFSA-N |
| XLogP | 4.34 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one?
The IUPAC name of ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one (CID 145237095) is ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one.
What is the SMILES notation for ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one?
The canonical SMILES for ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one is C.C=CC(=O)/C(C=C)=N/C=C(C)CC.CC.
What is the InChIKey of ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one?
The InChIKey is WZHCNSJFAZILAV-UIXGFHDFSA-N. The full InChI is InChI=1S/C11H15NO.C2H6.CH4/c1-5-9(4)8-12-10(6-2)11(13)7-3;1-2;/h6-8H,2-3,5H2,1,4H3;1-2H3;1H4/b9-8?,12-10+;;.
What are the key properties of ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one?
ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one has a molecular weight of 223.36 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;4-(2-methylbut-1-enylimino)hexa-1,5-dien-3-one is sourced from PubChem (CID 145237095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).