C12H19NO — CID 145237112
(2Z,4E)-5-ethenyl-3-methylocta-2,4,7-trien-4-ol;methanimine (PubChem CID 145237112) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2Z,4E)-5-ethenyl-3-methylocta-2,4,7-trien-4-ol;methanimine.
| Compound Name | (2Z,4E)-5-ethenyl-3-methylocta-2,4,7-trien-4-ol;methanimine |
|---|---|
| PubChem CID | 145237112 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2Z,4E)-5-ethenyl-3-methylocta-2,4,7-trien-4-ol;methanimine |
| SMILES | C=CC/C(C=C)=C(O)/C(C)=C\C.[H]N=C |
| InChI | InChI=1S/C11H16O.CH3N/c1-5-8-10(7-3)11(12)9(4)6-2;1-2/h5-7,12H,1,3,8H2,2,4H3;2H,1H2/b9-6-,11-10-; |
| InChIKey | SQYFSMPVFLBACU-YLXXVOGESA-N |
| XLogP | 3.79 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|