About 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile
4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile (PubChem CID 145237541) has the molecular formula C18H28N4
and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile |
| PubChem CID | 145237541 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile |
| SMILES | CN1CCC(C#N)(N2CCN(CC3=CCCC=C3)CC2)CC1 |
| InChI | InChI=1S/C18H28N4/c1-20-9-7-18(16-19,8-10-20)22-13-11-21(12-14-22)15-17-5-3-2-4-6-17/h3,5-6H,2,4,7-15H2,1H3 |
| InChIKey | RQEUQCRXKXUSHF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile?
The IUPAC name of 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile (CID 145237541) is 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile.
What is the SMILES notation for 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile?
The canonical SMILES for 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile is CN1CCC(C#N)(N2CCN(CC3=CCCC=C3)CC2)CC1.
What is the InChIKey of 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile?
The InChIKey is RQEUQCRXKXUSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4/c1-20-9-7-18(16-19,8-10-20)22-13-11-21(12-14-22)15-17-5-3-2-4-6-17/h3,5-6H,2,4,7-15H2,1H3.
What are the key properties of 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile?
4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile has a molecular weight of 300.45 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(cyclohexa-1,5-dien-1-ylmethyl)piperazin-1-yl]-1-methylpiperidine-4-carbonitrile is sourced from PubChem (CID 145237541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).