C11H18O3 — CID 145237835
1-(hydroxymethyl)-4-propan-2-ylcyclohex-3-ene-1-carboxylic acid (PubChem CID 145237835) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(hydroxymethyl)-4-propan-2-ylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 1-(hydroxymethyl)-4-propan-2-ylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 145237835 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-(hydroxymethyl)-4-propan-2-ylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)C1=CCC(CO)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H18O3/c1-8(2)9-3-5-11(7-12,6-4-9)10(13)14/h3,8,12H,4-7H2,1-2H3,(H,13,14) |
| InChIKey | LCQSYSCXHYIJEH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|