C12H12F4N2O — CID 145238385
2,2,2-trifluoroethyl (1Z)-4-ethyl-3-fluoro-N-methylidenebenzenecarbohydrazonate (PubChem CID 145238385) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1Z)-4-ethyl-3-fluoro-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2,2-trifluoroethyl (1Z)-4-ethyl-3-fluoro-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238385 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,2,2-trifluoroethyl (1Z)-4-ethyl-3-fluoro-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)(F)F)c1ccc(CC)c(F)c1 |
| InChI | InChI=1S/C12H12F4N2O/c1-3-8-4-5-9(6-10(8)13)11(18-17-2)19-7-12(14,15)16/h4-6H,2-3,7H2,1H3/b18-11- |
| InChIKey | LOGKHMQKZRBYSO-WQRHYEAKSA-N |
| XLogP | 3.33 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|