C27H30F2N4OS — CID 145238838
2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate;N-phenylthiohydroxylamine (PubChem CID 145238838) has the molecular formula C27H30F2N4OS and a molecular weight of 496.63 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate;N-phenylthiohydroxylamine.
| Compound Name | 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate;N-phenylthiohydroxylamine |
|---|---|
| PubChem CID | 145238838 |
| Molecular Formula | C27H30F2N4OS |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-[3-(1,3-dihydroisoindol-2-yl)propyl]-N-methylidenebenzenecarbohydrazonate;N-phenylthiohydroxylamine |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CCCN2Cc3ccccc3C2)cc1.SNc1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O.C6H7NS/c1-24-25-21(27-15-20(22)23)17-10-8-16(9-11-17)5-4-12-26-13-18-6-2-3-7-19(18)14-26;8-7-6-4-2-1-3-5-6/h2-3,6-11,20H,1,4-5,12-15H2;1-5,7-8H/b25-21-; |
| InChIKey | GJHYAXSKQRHLDF-NBFRYIKDSA-N |
| XLogP | 6.22 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|