C24H30F2N6O3S — CID 145239691
2,2-difluoroethyl (3Z)-6-[(N-(4-acetyl-3,5-dimethylpiperazin-1-yl)sulfinylanilino)methyl]-N-methylidenepyridine-3-carbohydrazonate (PubChem CID 145239691) has the molecular formula C24H30F2N6O3S and a molecular weight of 520.61 g/mol. Its IUPAC name is 2,2-difluoroethyl (3Z)-6-[(N-(4-acetyl-3,5-dimethylpiperazin-1-yl)sulfinylanilino)methyl]-N-methylidenepyridine-3-carbohydrazonate.
| Compound Name | 2,2-difluoroethyl (3Z)-6-[(N-(4-acetyl-3,5-dimethylpiperazin-1-yl)sulfinylanilino)methyl]-N-methylidenepyridine-3-carbohydrazonate |
|---|---|
| PubChem CID | 145239691 |
| Molecular Formula | C24H30F2N6O3S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2,2-difluoroethyl (3Z)-6-[(N-(4-acetyl-3,5-dimethylpiperazin-1-yl)sulfinylanilino)methyl]-N-methylidenepyridine-3-carbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(c2ccccc2)S(=O)N2CC(C)N(C(C)=O)C(C)C2)nc1 |
| InChI | InChI=1S/C24H30F2N6O3S/c1-17-13-30(14-18(2)32(17)19(3)33)36(34)31(22-8-6-5-7-9-22)15-21-11-10-20(12-28-21)24(29-27-4)35-16-23(25)26/h5-12,17-18,23H,4,13-16H2,1-3H3/b29-24- |
| InChIKey | WMHXBJUXPFMUKD-OLFWJLLRSA-N |
| XLogP | 3.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|