About S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine
S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine (PubChem CID 145239891) has the molecular formula C11H17FN2S2
and a molecular weight of 260.40 g/mol. Its IUPAC name is S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine.
Molecular Properties
| Compound Name | S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine |
| PubChem CID | 145239891 |
| Molecular Formula | C11H17FN2S2 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine |
| SMILES | C1CSCCN1.Cc1cc(SN)ccc1F |
| InChI | InChI=1S/C7H8FNS.C4H9NS/c1-5-4-6(10-9)2-3-7(5)8;1-3-6-4-2-5-1/h2-4H,9H2,1H3;5H,1-4H2 |
| InChIKey | AACYZCOORHOZIP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine?
The IUPAC name of S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine (CID 145239891) is S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine.
What is the SMILES notation for S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine?
The canonical SMILES for S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine is C1CSCCN1.Cc1cc(SN)ccc1F.
What is the InChIKey of S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine?
The InChIKey is AACYZCOORHOZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNS.C4H9NS/c1-5-4-6(10-9)2-3-7(5)8;1-3-6-4-2-5-1/h2-4H,9H2,1H3;5H,1-4H2.
What are the key properties of S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine?
S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine has a molecular weight of 260.40 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-fluoro-3-methylphenyl)thiohydroxylamine;thiomorpholine is sourced from PubChem (CID 145239891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).