C29H60 — CID 145240141
(3E)-14-butyl-4,17-dimethylbicyclo[8.7.0]heptadec-3-ene;ethane (PubChem CID 145240141) has the molecular formula C29H60 and a molecular weight of 408.80 g/mol. Its IUPAC name is (3E)-14-butyl-4,17-dimethylbicyclo[8.7.0]heptadec-3-ene;ethane.
| Compound Name | (3E)-14-butyl-4,17-dimethylbicyclo[8.7.0]heptadec-3-ene;ethane |
|---|---|
| PubChem CID | 145240141 |
| Molecular Formula | C29H60 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.47 |
| IUPAC Name | (3E)-14-butyl-4,17-dimethylbicyclo[8.7.0]heptadec-3-ene;ethane |
| SMILES | CC.CC.CC.CCCCC1CCCC2CCCCC/C(C)=C/CC2C(C)CC1 |
| InChI | InChI=1S/C23H42.3C2H6/c1-4-5-11-21-12-9-14-22-13-8-6-7-10-19(2)15-18-23(22)20(3)16-17-21;3*1-2/h15,20-23H,4-14,16-18H2,1-3H3;3*1-2H3/b19-15+;;; |
| InChIKey | CSPQIARYGGBQFI-OSPSBOFQSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|