C22H42O4Si2 — CID 14524037
methyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate (PubChem CID 14524037) has the molecular formula C22H42O4Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is methyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate.
| Compound Name | methyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 14524037 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | methyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C/C(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4Si2/c1-16-17(14-20(23)24-8)13-18(25-27(9,10)21(2,3)4)15-19(16)26-28(11,12)22(5,6)7/h14,18-19H,1,13,15H2,2-12H3/b17-14+/t18-,19+/m1/s1 |
| InChIKey | NRFMPIHOIWJPLB-KHCHXBIHSA-N |
| XLogP | 6.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|