C42H57F2NO3 — CID 145240610
1-(1,1-difluoroethyl)-1-[(1Z)-1-methoxy-3-methylbuta-1,3-dienyl]cyclopropane;1-[2-methyl-4-[6-[(4-propylphenyl)methyl]-3-pyridinyl]phenyl]propan-2-one;1-propoxypropane (PubChem CID 145240610) has the molecular formula C42H57F2NO3 and a molecular weight of 661.92 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-1-[(1Z)-1-methoxy-3-methylbuta-1,3-dienyl]cyclopropane;1-[2-methyl-4-[6-[(4-propylphenyl)methyl]-3-pyridinyl]phenyl]propan-2-one;1-propoxypropane.
| Compound Name | 1-(1,1-difluoroethyl)-1-[(1Z)-1-methoxy-3-methylbuta-1,3-dienyl]cyclopropane;1-[2-methyl-4-[6-[(4-propylphenyl)methyl]-3-pyridinyl]phenyl]propan-2-one;1-propoxypropane |
|---|---|
| PubChem CID | 145240610 |
| Molecular Formula | C42H57F2NO3 |
| Molecular Weight | 661.92 g/mol |
| Exact Mass | 661.43 |
| IUPAC Name | 1-(1,1-difluoroethyl)-1-[(1Z)-1-methoxy-3-methylbuta-1,3-dienyl]cyclopropane;1-[2-methyl-4-[6-[(4-propylphenyl)methyl]-3-pyridinyl]phenyl]propan-2-one;1-propoxypropane |
| SMILES | C=C(C)/C=C(\OC)C1(C(C)(F)F)CC1.CCCOCCC.CCCc1ccc(Cc2ccc(-c3ccc(CC(C)=O)c(C)c3)cn2)cc1 |
| InChI | InChI=1S/C25H27NO.C11H16F2O.C6H14O/c1-4-5-20-6-8-21(9-7-20)16-25-13-12-24(17-26-25)23-11-10-22(15-19(3)27)18(2)14-23;1-8(2)7-9(14-4)11(5-6-11)10(3,12)13;1-3-5-7-6-4-2/h6-14,17H,4-5,15-16H2,1-3H3;7H,1,5-6H2,2-4H3;3-6H2,1-2H3/b;9-7-; |
| InChIKey | OESKQUOBQNLFOP-ASRJFLFRSA-N |
| XLogP | 11.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.92 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|