About 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane
1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane (PubChem CID 145240893) has the molecular formula C14H16ClFN2O2
and a molecular weight of 298.75 g/mol. Its IUPAC name is 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane.
Molecular Properties
| Compound Name | 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane |
| PubChem CID | 145240893 |
| Molecular Formula | C14H16ClFN2O2 |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane |
| SMILES | CCC.Cc1c(-n2cc(C(=O)O)cn2)ccc(Cl)c1F |
| InChI | InChI=1S/C11H8ClFN2O2.C3H8/c1-6-9(3-2-8(12)10(6)13)15-5-7(4-14-15)11(16)17;1-3-2/h2-5H,1H3,(H,16,17);3H2,1-2H3 |
| InChIKey | SHTSECFTZPFJJX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane?
The IUPAC name of 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane (CID 145240893) is 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane.
What is the SMILES notation for 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane?
The canonical SMILES for 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane is CCC.Cc1c(-n2cc(C(=O)O)cn2)ccc(Cl)c1F.
What is the InChIKey of 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane?
The InChIKey is SHTSECFTZPFJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O2.C3H8/c1-6-9(3-2-8(12)10(6)13)15-5-7(4-14-15)11(16)17;1-3-2/h2-5H,1H3,(H,16,17);3H2,1-2H3.
What are the key properties of 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane?
1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane has a molecular weight of 298.75 g/mol, XLogP of 4.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-3-fluoro-2-methylphenyl)pyrazole-4-carboxylic acid;propane is sourced from PubChem (CID 145240893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).