About ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate
ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate (PubChem CID 145241360) has the molecular formula C7H10F3NS
and a molecular weight of 197.22 g/mol. Its IUPAC name is ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate.
Molecular Properties
| Compound Name | ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate |
| PubChem CID | 145241360 |
| Molecular Formula | C7H10F3NS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate |
| SMILES | C=C(/N=C(\C)SCC)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NS/c1-4-12-6(3)11-5(2)7(8,9)10/h2,4H2,1,3H3/b11-6+ |
| InChIKey | FUVPRYJWGSUVBD-IZZDOVSWSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate?
The IUPAC name of ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate (CID 145241360) is ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate.
What is the SMILES notation for ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate?
The canonical SMILES for ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate is C=C(/N=C(\C)SCC)C(F)(F)F.
What is the InChIKey of ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate?
The InChIKey is FUVPRYJWGSUVBD-IZZDOVSWSA-N. The full InChI is InChI=1S/C7H10F3NS/c1-4-12-6(3)11-5(2)7(8,9)10/h2,4H2,1,3H3/b11-6+.
What are the key properties of ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate?
ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate has a molecular weight of 197.22 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(3,3,3-trifluoroprop-1-en-2-yl)ethanimidothioate is sourced from PubChem (CID 145241360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).