About [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine
[(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine (PubChem CID 145241433) has the molecular formula C18H21FN4
and a molecular weight of 312.39 g/mol. Its IUPAC name is [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine.
Molecular Properties
| Compound Name | [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine |
| PubChem CID | 145241433 |
| Molecular Formula | C18H21FN4 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine |
| SMILES | NN/C(CF)=C1\NCCN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H21FN4/c19-12-16(22-20)18-15-8-4-5-9-17(15)23(11-10-21-18)13-14-6-2-1-3-7-14/h1-9,21-22H,10-13,20H2/b18-16- |
| InChIKey | JRCPOKRAGZXFJQ-VLGSPTGOSA-N |
| XLogP | 2.40 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine?
The IUPAC name of [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine (CID 145241433) is [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine.
What is the SMILES notation for [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine?
The canonical SMILES for [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine is NN/C(CF)=C1\NCCN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine?
The InChIKey is JRCPOKRAGZXFJQ-VLGSPTGOSA-N. The full InChI is InChI=1S/C18H21FN4/c19-12-16(22-20)18-15-8-4-5-9-17(15)23(11-10-21-18)13-14-6-2-1-3-7-14/h1-9,21-22H,10-13,20H2/b18-16-.
What are the key properties of [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine?
[(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine has a molecular weight of 312.39 g/mol, XLogP of 2.40, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-1-(1-benzyl-3,4-dihydro-2H-1,4-benzodiazepin-5-ylidene)-2-fluoroethyl]hydrazine is sourced from PubChem (CID 145241433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).