About (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen
(2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen (PubChem CID 145241674) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen.
Molecular Properties
| Compound Name | (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen |
| PubChem CID | 145241674 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen |
| SMILES | C=C/C=C(\C=C/C)C(=O)NCc1cncc(C)n1.[H][H] |
| InChI | InChI=1S/C14H17N3O.H2/c1-4-6-12(7-5-2)14(18)16-10-13-9-15-8-11(3)17-13;/h4-9H,1,10H2,2-3H3,(H,16,18);1H/b7-5-,12-6+; |
| InChIKey | DSAAUYPCYPVOEB-AOMYCQKGSA-N |
| XLogP | 2.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen?
The IUPAC name of (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen (CID 145241674) is (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen.
What is the SMILES notation for (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen?
The canonical SMILES for (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen is C=C/C=C(\C=C/C)C(=O)NCc1cncc(C)n1.[H][H].
What is the InChIKey of (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen?
The InChIKey is DSAAUYPCYPVOEB-AOMYCQKGSA-N. The full InChI is InChI=1S/C14H17N3O.H2/c1-4-6-12(7-5-2)14(18)16-10-13-9-15-8-11(3)17-13;/h4-9H,1,10H2,2-3H3,(H,16,18);1H/b7-5-,12-6+;.
What are the key properties of (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen?
(2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen has a molecular weight of 245.33 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-[(6-methylpyrazin-2-yl)methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;molecular hydrogen is sourced from PubChem (CID 145241674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).