About 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane
1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane (PubChem CID 145241839) has the molecular formula C15H28N4O2S
and a molecular weight of 328.48 g/mol. Its IUPAC name is 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane.
Molecular Properties
| Compound Name | 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane |
| PubChem CID | 145241839 |
| Molecular Formula | C15H28N4O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane |
| SMILES | C.CC.CCCCCn1c(=S)[nH]c2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H18N4O2S.C2H6.CH4/c1-4-5-6-7-16-8-9(13-11(16)19)14(2)12(18)15(3)10(8)17;1-2;/h4-7H2,1-3H3,(H,13,19);1-2H3;1H4 |
| InChIKey | YTHDPYLXODQSML-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane?
The IUPAC name of 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane (CID 145241839) is 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane.
What is the SMILES notation for 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane?
The canonical SMILES for 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane is C.CC.CCCCCn1c(=S)[nH]c2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane?
The InChIKey is YTHDPYLXODQSML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2S.C2H6.CH4/c1-4-5-6-7-16-8-9(13-11(16)19)14(2)12(18)15(3)10(8)17;1-2;/h4-7H2,1-3H3,(H,13,19);1-2H3;1H4.
What are the key properties of 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane?
1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane has a molecular weight of 328.48 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7-pentyl-8-sulfanylidene-9H-purine-2,6-dione;ethane;methane is sourced from PubChem (CID 145241839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).