C24H31Cl2F3N6OS — CID 145242274
5-[5-[3-[(3aR,7aS)-1-[4-(trifluoromethyl)phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole;dihydrochloride (PubChem CID 145242274) has the molecular formula C24H31Cl2F3N6OS and a molecular weight of 579.52 g/mol. Its IUPAC name is 5-[5-[3-[(3aR,7aS)-1-[4-(trifluoromethyl)phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole;dihydrochloride.
| Compound Name | 5-[5-[3-[(3aR,7aS)-1-[4-(trifluoromethyl)phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole;dihydrochloride |
|---|---|
| PubChem CID | 145242274 |
| Molecular Formula | C24H31Cl2F3N6OS |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 5-[5-[3-[(3aR,7aS)-1-[4-(trifluoromethyl)phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole;dihydrochloride |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2CC[C@@H]3CCN(c4ccc(C(F)(F)F)cc4)[C@@H]3C2)n1C.Cl.Cl |
| InChI | InChI=1S/C24H29F3N6OS.2ClH/c1-16-21(34-15-28-16)22-29-30-23(31(22)2)35-13-3-10-32-11-8-17-9-12-33(20(17)14-32)19-6-4-18(5-7-19)24(25,26)27;;/h4-7,15,17,20H,3,8-14H2,1-2H3;2*1H/t17-,20-;;/m1../s1 |
| InChIKey | FFNQGFBRNYJQEV-FDCKWBIYSA-N |
| XLogP | 5.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|