C21H46N4OS2 — CID 145242294
ethane;6-methyl-1-sulfanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;6-propyl-4-sulfanyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 145242294) has the molecular formula C21H46N4OS2 and a molecular weight of 434.76 g/mol. Its IUPAC name is ethane;6-methyl-1-sulfanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;6-propyl-4-sulfanyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | ethane;6-methyl-1-sulfanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;6-propyl-4-sulfanyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 145242294 |
| Molecular Formula | C21H46N4OS2 |
| Molecular Weight | 434.76 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | ethane;6-methyl-1-sulfanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;6-propyl-4-sulfanyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CC.CC.CCCN1CC2OCCN(S)C2C1.CN1CC2CCCN(S)C2C1 |
| InChI | InChI=1S/C9H18N2OS.C8H16N2S.2C2H6/c1-2-3-10-6-8-9(7-10)12-5-4-11(8)13;1-9-5-7-3-2-4-10(11)8(7)6-9;2*1-2/h8-9,13H,2-7H2,1H3;7-8,11H,2-6H2,1H3;2*1-2H3 |
| InChIKey | LIRGXLHCBHHYMS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 22.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|