About 2-oxo-1,3-oxazolidine-4-carboxamide
2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 14524248) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-oxo-1,3-oxazolidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-1,3-oxazolidine-4-carboxamide |
| PubChem CID | 14524248 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | NC(=O)C1COC(=O)N1 |
| InChI | InChI=1S/C4H6N2O3/c5-3(7)2-1-9-4(8)6-2/h2H,1H2,(H2,5,7)(H,6,8) |
| InChIKey | YVPQLLAPXOYFIC-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-1,3-oxazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3-oxazolidine-4-carboxamide?
The IUPAC name of 2-oxo-1,3-oxazolidine-4-carboxamide (CID 14524248) is 2-oxo-1,3-oxazolidine-4-carboxamide.
What is the SMILES notation for 2-oxo-1,3-oxazolidine-4-carboxamide?
The canonical SMILES for 2-oxo-1,3-oxazolidine-4-carboxamide is NC(=O)C1COC(=O)N1.
What is the InChIKey of 2-oxo-1,3-oxazolidine-4-carboxamide?
The InChIKey is YVPQLLAPXOYFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3/c5-3(7)2-1-9-4(8)6-2/h2H,1H2,(H2,5,7)(H,6,8).
What are the key properties of 2-oxo-1,3-oxazolidine-4-carboxamide?
2-oxo-1,3-oxazolidine-4-carboxamide has a molecular weight of 130.10 g/mol, XLogP of -1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-oxazolidine-4-carboxamide is sourced from PubChem (CID 14524248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).