C22H31FN2 — CID 145244191
N-[5-fluoro-2-methyl-4-[(1E,3E)-1-(methylideneamino)hexa-1,3-dien-2-yl]phenyl]octan-4-imine (PubChem CID 145244191) has the molecular formula C22H31FN2 and a molecular weight of 342.50 g/mol. Its IUPAC name is N-[5-fluoro-2-methyl-4-[(1E,3E)-1-(methylideneamino)hexa-1,3-dien-2-yl]phenyl]octan-4-imine.
| Compound Name | N-[5-fluoro-2-methyl-4-[(1E,3E)-1-(methylideneamino)hexa-1,3-dien-2-yl]phenyl]octan-4-imine |
|---|---|
| PubChem CID | 145244191 |
| Molecular Formula | C22H31FN2 |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N-[5-fluoro-2-methyl-4-[(1E,3E)-1-(methylideneamino)hexa-1,3-dien-2-yl]phenyl]octan-4-imine |
| SMILES | C=N/C=C(\C=C\CC)c1cc(C)c(/N=C(\CCC)CCCC)cc1F |
| InChI | InChI=1S/C22H31FN2/c1-6-9-12-18(16-24-5)20-14-17(4)22(15-21(20)23)25-19(11-8-3)13-10-7-2/h9,12,14-16H,5-8,10-11,13H2,1-4H3/b12-9+,18-16+,25-19+ |
| InChIKey | MAXRUZRZQVSMDJ-RCSSUEGESA-N |
| XLogP | 7.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|