C24H27ClN4O — CID 145244444
2-[5-[3-chloro-4-[[(3E,5Z)-hepta-3,5-dien-3-yl]amino]-2-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol (PubChem CID 145244444) has the molecular formula C24H27ClN4O and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-[5-[3-chloro-4-[[(3E,5Z)-hepta-3,5-dien-3-yl]amino]-2-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol.
| Compound Name | 2-[5-[3-chloro-4-[[(3E,5Z)-hepta-3,5-dien-3-yl]amino]-2-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 145244444 |
| Molecular Formula | C24H27ClN4O |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[5-[3-chloro-4-[[(3E,5Z)-hepta-3,5-dien-3-yl]amino]-2-methylquinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
| SMILES | C/C=C\C=C(/CC)Nc1c(Cl)c(C)nc2ccc(-c3cnc(C(C)(C)O)nc3)cc12 |
| InChI | InChI=1S/C24H27ClN4O/c1-6-8-9-18(7-2)29-22-19-12-16(10-11-20(19)28-15(3)21(22)25)17-13-26-23(27-14-17)24(4,5)30/h6,8-14,30H,7H2,1-5H3,(H,28,29)/b8-6-,18-9+ |
| InChIKey | RMHZKOICKKTOKI-VOTISDMWSA-N |
| XLogP | 6.16 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|