C29H33ClFN3O — CID 145244605
3-chloro-N-[(2-fluoro-5-methoxyphenyl)methyl]-6-[(1E,3E)-1-(hexan-2-ylideneamino)hexa-1,3-dien-2-yl]quinolin-4-amine (PubChem CID 145244605) has the molecular formula C29H33ClFN3O and a molecular weight of 494.05 g/mol. Its IUPAC name is 3-chloro-N-[(2-fluoro-5-methoxyphenyl)methyl]-6-[(1E,3E)-1-(hexan-2-ylideneamino)hexa-1,3-dien-2-yl]quinolin-4-amine.
| Compound Name | 3-chloro-N-[(2-fluoro-5-methoxyphenyl)methyl]-6-[(1E,3E)-1-(hexan-2-ylideneamino)hexa-1,3-dien-2-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 145244605 |
| Molecular Formula | C29H33ClFN3O |
| Molecular Weight | 494.05 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 3-chloro-N-[(2-fluoro-5-methoxyphenyl)methyl]-6-[(1E,3E)-1-(hexan-2-ylideneamino)hexa-1,3-dien-2-yl]quinolin-4-amine |
| SMILES | CC/C=C/C(=C\N=C(/C)CCCC)c1ccc2ncc(Cl)c(NCc3cc(OC)ccc3F)c2c1 |
| InChI | InChI=1S/C29H33ClFN3O/c1-5-7-9-20(3)32-17-22(10-8-6-2)21-11-14-28-25(16-21)29(26(30)19-33-28)34-18-23-15-24(35-4)12-13-27(23)31/h8,10-17,19H,5-7,9,18H2,1-4H3,(H,33,34)/b10-8+,22-17+,32-20+ |
| InChIKey | QIBNRXPLZZZDST-GUPDWDNXSA-N |
| XLogP | 8.61 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.05 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|