C19H16N6 — CID 145244759
5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(3H-imidazo[4,5-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145244759) has the molecular formula C19H16N6 and a molecular weight of 328.38 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(3H-imidazo[4,5-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(3H-imidazo[4,5-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 145244759 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-(3H-imidazo[4,5-c]pyridin-2-yl)-1H-pyrazolo[4,3-b]pyridine |
| SMILES | C=C/C=C\C(=C/C)c1ccc2[nH]nc(-c3nc4ccncc4[nH]3)c2n1 |
| InChI | InChI=1S/C19H16N6/c1-3-5-6-12(4-2)13-7-8-15-17(21-13)18(25-24-15)19-22-14-9-10-20-11-16(14)23-19/h3-11H,1H2,2H3,(H,22,23)(H,24,25)/b6-5-,12-4+ |
| InChIKey | TVJMTQFTKMCRLV-JWUPWDRQSA-N |
| XLogP | 4.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|