About 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one
4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one (PubChem CID 14524507) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one |
| PubChem CID | 14524507 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one |
| SMILES | C=CCCCCCCCC/C=C/C1=CC(C)OC1=O |
| InChI | InChI=1S/C17H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14-15(2)19-17(16)18/h3,12-15H,1,4-11H2,2H3/b13-12+ |
| InChIKey | OOSLHKAKZTXLFK-OUKQBFOZSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one?
The IUPAC name of 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one (CID 14524507) is 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one.
What is the SMILES notation for 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one?
The canonical SMILES for 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one is C=CCCCCCCCC/C=C/C1=CC(C)OC1=O.
What is the InChIKey of 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one?
The InChIKey is OOSLHKAKZTXLFK-OUKQBFOZSA-N. The full InChI is InChI=1S/C17H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14-15(2)19-17(16)18/h3,12-15H,1,4-11H2,2H3/b13-12+.
What are the key properties of 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one?
4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one has a molecular weight of 262.39 g/mol, XLogP of 4.72, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-dodeca-1,11-dienyl]-2-methyl-2H-furan-5-one is sourced from PubChem (CID 14524507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).