C18H29N3O6S3 — CID 1452453
1-ethylsulfonyl-4-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]sulfonylpiperazine (PubChem CID 1452453) has the molecular formula C18H29N3O6S3 and a molecular weight of 479.65 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]sulfonylpiperazine.
| Compound Name | 1-ethylsulfonyl-4-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 1452453 |
| Molecular Formula | C18H29N3O6S3 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-ethylsulfonyl-4-[4-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]sulfonylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCC[C@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O6S3/c1-3-28(22,23)19-11-13-20(14-12-19)29(24,25)17-6-8-18(9-7-17)30(26,27)21-10-4-5-16(2)15-21/h6-9,16H,3-5,10-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | UNFCORFTQSTJRC-INIZCTEOSA-N |
| XLogP | 0.76 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |