About tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane
tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane (PubChem CID 14524752) has the molecular formula C23H32O3Si
and a molecular weight of 384.59 g/mol. Its IUPAC name is tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane |
| PubChem CID | 14524752 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)OC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H32O3Si/c1-22(2,3)27(20-12-8-6-9-13-20,21-14-10-7-11-15-21)25-17-16-19-18-24-23(4,5)26-19/h6-15,19H,16-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | DTICEIYPTKVBKF-IBGZPJMESA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane (CID 14524752) is tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane is CC1(C)OC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1.
What is the InChIKey of tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane?
The InChIKey is DTICEIYPTKVBKF-IBGZPJMESA-N. The full InChI is InChI=1S/C23H32O3Si/c1-22(2,3)27(20-12-8-6-9-13-20,21-14-10-7-11-15-21)25-17-16-19-18-24-23(4,5)26-19/h6-15,19H,16-18H2,1-5H3/t19-/m0/s1.
What are the key properties of tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane?
tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane has a molecular weight of 384.59 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-diphenylsilane is sourced from PubChem (CID 14524752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).