About 2-methoxypyran-4-one
2-methoxypyran-4-one (PubChem CID 14524777) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 2-methoxypyran-4-one.
Molecular Properties
| Compound Name | 2-methoxypyran-4-one |
| PubChem CID | 14524777 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2-methoxypyran-4-one |
| SMILES | COc1cc(=O)cco1 |
| InChI | InChI=1S/C6H6O3/c1-8-6-4-5(7)2-3-9-6/h2-4H,1H3 |
| InChIKey | CQUVDLZCHKUKHF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxypyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyran-4-one?
The IUPAC name of 2-methoxypyran-4-one (CID 14524777) is 2-methoxypyran-4-one.
What is the SMILES notation for 2-methoxypyran-4-one?
The canonical SMILES for 2-methoxypyran-4-one is COc1cc(=O)cco1.
What is the InChIKey of 2-methoxypyran-4-one?
The InChIKey is CQUVDLZCHKUKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c1-8-6-4-5(7)2-3-9-6/h2-4H,1H3.
What are the key properties of 2-methoxypyran-4-one?
2-methoxypyran-4-one has a molecular weight of 126.11 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyran-4-one is sourced from PubChem (CID 14524777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).