C36H35FN4 — CID 145248160
(3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(4-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145248160) has the molecular formula C36H35FN4 and a molecular weight of 542.70 g/mol. Its IUPAC name is (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(4-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(4-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145248160 |
| Molecular Formula | C36H35FN4 |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(4-fluorophenyl)-1H-indol-2-yl]-1H-indazol-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5ccc(F)cc5)cccc4[nH]3)c2c1)NC(=C)C1CCCCC1 |
| InChI | InChI=1S/C36H35FN4/c1-4-24(20-29(5-2)38-23(3)25-10-7-6-8-11-25)27-16-19-34-32(21-27)36(41-40-34)35-22-31-30(12-9-13-33(31)39-35)26-14-17-28(37)18-15-26/h4-5,9,12-22,25,38-39H,2-3,6-8,10-11H2,1H3,(H,40,41)/b24-4+,29-20+ |
| InChIKey | YXGGIRSYAUYVAV-GCMYHWAOSA-N |
| XLogP | 9.67 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|