C33H33FIN7O2 — CID 145248573
2-[3-fluoro-5-[2-[5-(5-piperidin-4-yloxy-1λ3-iodacyclohexa-2,4,6-trien-3-yl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]phenoxy]-N,N-dimethylethanamine (PubChem CID 145248573) has the molecular formula C33H33FIN7O2 and a molecular weight of 705.58 g/mol. Its IUPAC name is 2-[3-fluoro-5-[2-[5-(5-piperidin-4-yloxy-1λ3-iodacyclohexa-2,4,6-trien-3-yl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[3-fluoro-5-[2-[5-(5-piperidin-4-yloxy-1λ3-iodacyclohexa-2,4,6-trien-3-yl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 145248573 |
| Molecular Formula | C33H33FIN7O2 |
| Molecular Weight | 705.58 g/mol |
| Exact Mass | 705.17 |
| IUPAC Name | 2-[3-fluoro-5-[2-[5-(5-piperidin-4-yloxy-1λ3-iodacyclohexa-2,4,6-trien-3-yl)-2H-pyrazolo[3,4-b]pyridin-3-yl]-1H-pyrrolo[3,2-c]pyridin-4-yl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cc(F)cc(-c2nccc3[nH]c(-c4[nH]nc5ncc(C6=CI=CC(OC7CCNCC7)=C6)cc45)cc23)c1 |
| InChI | InChI=1S/C33H33FIN7O2/c1-42(2)9-10-43-25-12-20(11-23(34)15-25)31-27-16-30(39-29(27)5-8-37-31)32-28-14-22(19-38-33(28)41-40-32)21-13-26(18-35-17-21)44-24-3-6-36-7-4-24/h5,8,11-19,24,36,39H,3-4,6-7,9-10H2,1-2H3,(H,38,40,41) |
| InChIKey | GNZHTPSSEXEAEU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|